|
|
531, SOMWAR PETH
|
FINE CHEMICALS
| CODE | DESCRIPTION | PACK |
| 2174 | SELENIUM STANDARD SOLUTION 1000 MG/L SM FOR ICP SELENIUM IN NITRIC ACID 5% | 100 ML |
| 3913 | MOHILE THERMOPRINTER® 3001 | 1 pack |
| 5612 | LANTHANUM STANDARD SOLUTION 1000MG/L LITHIUM NITRATE IN WATER | 500 ML |
| 10868 | Calcium gluconate Gel | 25 g |
| 11769 | Acetic acid ("glacial") 'AnalaR' | 2.5L |
| 11770 | Ammonium fluoride 'AnalaR' | 500G |
| 11771 | Ammonium formate 'AnalaR' | 500G |
| 11772 | Ammonium formate 'AnalaR' | 2.5KG |
| 11773 | Ammonium polysulphide solution 'AnalaR' | 2.5L |
| 11774 | iso-Amyl acetate 'AnalaR' | 2.5L |
| 11775 | iso-Amyl alcohol 'AnalaR' | 500ML |
| 11776 | iso-Amyl alcohol 'AnalaR' | 2.5L |
| 11777 | Antimony trichloride 'AnalaR' [antimony(III) chlorid | 100G |
| 11778 | Barium carbonate 'AnalaR' | 500G |
| 11779 | Barium hydroxide 'AnalaR' | 500G |
| 11780 | Cadmium sulphate 'AnalaR' | 500G |
| 11781 | Caesium chloride 'AnalaR' | 100G |
| 11782 | Chloroacetic acid 'AnalaR' | 500G |
| 11783 | Copper(II) nitrate 3-hydrate 'AnalaR' (cupric nitrat | 500G |
| 11784 | Diethyl ether 'AnalaR' | 1L |
| 11785 | Diethyl ether 'AnalaR' | 2.5L |
| 11786 | Dimethylglyoxime 'AnalaR' | 100G |
| 11787 | 1,5-Diphenylcarbazide 'AnalaR' | 25G |
| 11788 | 2,2'-Bipyridyl 'AnalaR' | 5G |
| 11789 | Ethanol 99.7-100% ("absolute") 'AnalaR' (duty free) | 500ML |
| 11790 | Iron(III) chloride 6-hydrate 'AnalaR' (ferric chlori | 500G |
| 11791 | Iron(III) chloride solution 'AnalaR' about 60% w/v F | 500ML |
| 11792 | Fusion mixture 'AnalaR' | 1KG |
| 11793 | 8-Hydroxyquinoline 'AnalaR' | 100G |
| 11794 | Mercury(II) chloride 'AnalaR' (mercuric chloride) | 25G |
| 11795 | Mercury(II) chloride 'AnalaR' (mercuric chloride) | 100G |
| 11796 | dodeca-Molybdophosphoric acid 'AnalaR' | 100G |
| 11797 | Petroleum spirit 100-120ºC 'AnalaR' | 1L |
| 11798 | Petroleum spirit 100-120ºC 'AnalaR' | 2.5L |
| 11799 | Petroleum spirit 120-160ºC 'AnalaR' | 1L |
| 11800 | tri-Potassium citrate 'AnalaR' | 500G |
| 11801 | Potassium hexacyanoferrate(II) 3-hydrate 'AnalaR' (p | 500G |
| 11802 | Potassium periodate 'AnalaR' | 100G |
| 11803 | Pyrogallol 'AnalaR' (1,2, 3-trihydroxybenzene) | 100G |
| 11804 | Pyrogallol 'AnalaR' (1,2, 3-trihydroxybenzene) | 500G |
| 11805 | Quinhydrone 'AnalaR' | 100G |
| 11806 | Salicylic acid 'AnalaR' | 500G |
| 11807 | Sodium carbonate anhydrous 'AnalaR' | 500G |
| 11808 | Sodium carbonate anhydrous 'AnalaR' | 1KG |
| 11809 | Sodium carbonate anhydrous 'AnalaR' | 5KG |
| 11810 | Sodium chloride 'AnalaR' | 500G |
| 11811 | Sodium chloride 'AnalaR' | 1KG |
| 11812 | Sodium diethyldithiocarbamate 'AnalaR' | 100G |
| 11813 | Sodium fluoride 'AnalaR' | 500G |
| 11814 | Sodium periodate 'AnalaR' (sodium metaperiodate) | 100G |
| 11815 | Sodium sulphide 'AnalaR' | 250G |
| 11816 | Sucrose 'AnalaR' | 1KG |
| 11817 | Trichloroacetic acid 'AnalaR' | 1KG |
| 11818 | dodeca-Tungstophosphoric acid 'AnalaR' | 100G |
| 11819 | L-Ascorbic acid 'AnalaR' | 100G |
| 11820 | L-Ascorbic acid 'AnalaR' | 500G |
| 11821 | Iron(III) nitrate 9-hydrate 'AnalaR' (ferric nitrate | 500G |
| 11822 | Sodium (+)-tartrate 'AnalaR' | 500G |
| 11823 | Hexamine 'AnalaR' | 500G |
| 11824 | n-Pentane 'AnalaR' | 1L |
| 11825 | Triethanolamine 'AnalaR' | 500ML |
| 11826 | Triethanolamine 'AnalaR' | 2.5L |
| 11827 | D(+)Xylose 'AnalaR' | 100G |
| 11828 | Maleic acid 'AnalaR' | 500G |
| 11829 | Sodium b-glycerophosphate 'AnalaR Biochemical' | 250G |
| 11830 | Toluene-4-sulphonic acid 'AnalaR' | 25G |
| 11831 | Caffeine 'AnalaR' | 250G |
| 11832 | N-1-Naphthylethylenediamine dihydrochloride 'AnalaR' | 10G |
| 11833 | Metol 'AnalaR' (4-methylaminophenol sulphate) | 500G |
| 11834 | Silver diethyldithiocarbamate 'AnalaR' | 10G |
| 11835 | Phenolindo-2,6-dichlorophenol sodium salt 'AnalaR' | 5G |
| 11836 | Ethylenediaminetetra-acetic acid dipotassium salt 'A | 500G |
| 11837 | Magnesium carbonate basic 'AnalaR' (magnesium hydrox | 100G |
| 11838 | Cadmium 'AnalaR' coarse powder 0.3-1.6 mm for reduct | 100G |
| 11839 | Sulphanilamide 'AnalaR' | 100G |
| 11840 | Sodium dichloroisocyanurate 'AnalaR' | 100G |
| 11841 | Sodium salicylate 'AnalaR' | 250G |
| 11842 | Dithiothreitol (Cleland's reagent) 'AnalaR' | 0.5G |
| 11843 | Dithiothreitol (Cleland's reagent) 'AnalaR' | 5G |
| 11844 | Cadmium chloride 1-hydrate 'AnalaR' | 500G |
| 11845 | di-Ammonium iron(II) sulphate 6-hydrate 'AnalaR' low | 500G |
| 11846 | 4-Nitrophenyl disodium orthophosphate 'AnalaR' | 5G |
| 11847 | 4-Nitrophenyl disodium orthophosphate 'AnalaR' | 25G |
| 11848 | Magnesium perchlorate dried suitable for micro analy | 100G |
| 11849 | Magnesium perchlorate dried suitable for micro analy | 500G |
| 11850 | Copper(II) oxide wire form 'suitable for micro analy | 100G |
| 11851 | 'Carbosorb AS' granules size 0.710-1.18 mm 'for micr | 100G |
| 11852 | Manganese(IV) oxide on carrier activated granular fo | 100G |
| 11853 | Acetanilide,CRM (LGC2404) | 0.5G |
| 11854 | Anisic Acid CRM (LGC2407) | 0.5G |
| 11855 | Anthraquinone CRM (LGC2410) | 0.5G |
| 11856 | Benzil CRM (LGC2403) | 0.5G |
| 11857 | Benzoic Acid CRM (LGC2405) | 0.5G |
| 11858 | Carbazole CRM (LGC2409) | 0.5G |
| 11859 | 2-Chloroanthraquinone CRM (LGC2408) | 0.5G |
| 11860 | Dibutyl Sulphide CRM (LGC4000) | 50ML |
| 11861 | DiPhenylacetic Acid CRM (LGC2406) | 0.5G |
| 11862 | Naphthalene CRM (LGC2402) | 0.5G |
| 11863 | 4-Nitrotoluene CRM (LGC2401) | 0.5G |
| 11864 | Acetanilide CRM (LGC4002) | 1G |
| 11865 | Arachidic Acid CRM (LGC4007) | 1G |
| 11866 | Benzoic Acid CRM (LGC4003) | 1G |
| 11867 | 4-Bromobenzoic Acid CRM (LGC4008) | 1G |
| 11868 | 4-Chlorobenzoic Acid CRM (LGC4004) | 1G |
| 11869 | Cyclohexanone-2, 4-Dinitro-phenylhydrazone (LGC4005) | 1G |
| 11870 | Dibenzothiophene CRM LGC4001 | 0.5G |
| 11871 | 2-Iodobenzoic Acid CRM (LGC4009) | 1G |
| 11872 | Milk Drink powder CRM (LGC7007) | 5G |
| 11873 | Milk powder CRM (LGC7006) | 5G |
| 11874 | Triphenylphosphine CRM LGC4006 | 1G |
| 11875 | Alizarin red S (sodium alizarinsulphonate) | 100G |
| 11876 | Calmagite [1-(1-hydroxy-4-methyl-2- phenylazo)-2-nap | 5G |
| 11877 | 3,4,3',4'-Tetra-aminobiphenyl hydrochloride | PK12 |
| 11878 | 3,4,3',4'-Tetra-aminobiphenyl hydrochloride | 1G |
| 11879 | Dimethylglyoxime GPR | 100G |
| 11880 | Dithio-oxamide (rubeanic acid) | 25G |
| 11881 | Dithizone GPR | 25G |
| 11882 | 2-Hydroxy-1-(2-hydroxy-4-sulpho- 1-naphthylazo)-3-na | 5G |
| 11883 | Xylenol orange | 5G |
| 11884 | Zincon | 5G |
| 11885 | 3-(2-Pyridyl)-5,6-bis(4-phenylsulphonic acid)-1,2,4- | 5G |
| 11886 | Potassium bromide 'SpectrosoL' for infra-red spectro | 100G |
| 11887 | Potassium dichromate standard solutions 'SpectrosoL' | EACH |
| 11888 | Holmium perchlorate standard solution 'SpectrosoL' | 100ML |
| 11889 | Ammonium pyrrolidine dithiocarbamate (APDC) 'Spectro | 25G |
| 11890 | Sodium borohydride pellets 'SpectrosoL' for atomic a | 100G |
| 11891 | Copper standard solution (1000 mg/l) 'SpectrosoL' | 100ML |
| 11892 | Iron standard solution (1000 mg/l) 'SpectrosoL' | 100ML |
| 11893 | Iron standard solution (1000 mg/l) 'SpectrosoL' | 500ML |
| 11894 | Nickel standard solution (1000 mg/l) 'SpectrosoL' | 100ML |
| 11895 | 2,5-Diphenyloxazole 'Scintran' (PPO) | 100G |
| 11896 | 2,5-Diphenyloxazole 'Scintran' (PPO) | 500G |
| 11897 | 1,4-Di-2-(5-phenyloxazolyl)benzene 'Scintran' (POPOP | 25G |
| 11898 | *Silica fumed (CAB-O-SIL M-5) 'Scintran' | 250G |
| 11899 | Polyethyleneimine solution about 50% ('Polymin P') | 250ML |
| 11900 | 'Amberlite' XAD-2 polymeric beads bead size 0.30-0.7 | 500G |
| 11901 | 'Amberlite' XAD-7 polymeric beads bead size 0.30-0.7 | 500G |
| 11906 | *'Celite' 545 | 250G |
| 11907 | *'Celite' 545 | 1KG |
| 11923 | 'Chlorotex' Reagent BDH | 500ML |
| 11924 | Folin & Ciocalteu's phenol reagent | 250ML |
| 11925 | Folin & Ciocalteu's phenol reagent | 500ML |
| 11926 | Phenoldisulphonic acid solution 25% w/v in sulphuric | 500ML |
| 11927 | Schiff's reagent for detection of aldehydes and use | 500ML |
| 11928 | Schiff's reagent for detection of aldehydes and use | 1L |
| 11929 | Tetra-n-butylammonium hydroxide solution GPR | 100ML |
| 11930 | Tetra-n-butylammonium hydroxide solution GPR | 500ML |
| 11931 | Tetramethylammonium hydroxide solution GPR about 25% | 100ML |
| 11932 | Tetra-n-butylammonium hydroxide 0.1 mol l-1 (0.1N) i | 500ML |
| 11933 | Tetra-n-butylammonium hydroxide 0.1 mol l-1 (0.1N) i | 2.5L |
| 11934 | Dimidium bromide-disulphine blue indicator stock sol | 100ML |
| 11935 | Cuprammonium hydroxide solution (Shirley's) | 500ML |
| 11936 | *Hyamine 1622 0.004M solution | 2.5L |
| 11937 | Barium diphenylaminesulphonate (redox indicator) | 5G |
| 11938 | Bromocresol green water soluble (pH indicator) | 5G |
| 11939 | o-Cresolphthalein complexone | 5G |
| 11940 | 2,7-Dichlorofluorescein adsorption indicator | 10G |
| 11941 | Iodine indicator BDH | 100G |
| 11942 | Litmus | 25G |
| 11943 | Methyl orange (pH indicator) | 25G |
| 11944 | Methyl orange (pH indicator) | 100G |
| 11945 | Methyl red (pH indicator) | 10G |
| 11946 | Methyl red (pH indicator) | 100G |
| 11947 | Phenolindo-2,6-dichlorophenol sodium salt redox indi | 5G |
| 11948 | Sodium diphenylaminesulphonate redox indicator | 25G |
| 11949 | Dimidium bromide (2,7-diamino-10-methyl- 9-phenylphe | 1G |
| 11950 | Thyodene indicator water soluble iodine indicator su | 200G |
| 11951 | BDH '4.5' Indicator | 500ML |
| 11952 | BDH '4.5' Indicator | 2.5L |
| 11953 | 1,10-Phenanthroline-ferrous sulphate-complex solutio | 100ML |
| 11954 | BDH Full Range Indicator | 500ML |
| 11955 | BDH Full Range Indicator | 2.5L |
| 11956 | Dichlorophenolindophenol tablets for the determinati | PK20 |
| 11957 | Dextran sulphate sodium salt | 25G |
| 11958 | 1-(4-Nitrophenyl)glycerol (PNPG) | 1G |
| 11959 | Ammonium hydrogen difluoride technical | 2.5KG |
| 11960 | Eosin technical dye | 100G |
| 11961 | Haematoxylin technical | 100G |
| 11962 | Sodium metasilicate technical | 2.5KG |
| 11963 | Oleic acid GPR | 2.5L |
| 11964 | Adrenaline hydrogen tartrate GPR (adrenaline acid ta | 5G |
| 11965 | NN-Dimethyl-p-phenylenediamine dihydrochloride GPR | 25G |
| 11966 | 2-Amino-2-methylpropan-1-ol GPR (b-amino-iso-butyl a | 500ML |
| 11967 | 4-Aminophenazone GPR | 100G |
| 11968 | Ammonium fluoride GPR | 500G |
| 11969 | Ammonium hydrogen difluoride GPR | 500G |
| 11970 | di-Ammonium nickel(II) sulphate 6-hydrate GPR (ammon | 500G |
| 11971 | Murexide (ammonium purpurate) | 25G |
| 11972 | Ammonium sodium hydrogen orthophosphate GPR (microco | 500G |
| 11973 | Ammonium sulphate for biochemistry | 500G |
| 11974 | Ammonium sulphate for biochemistry | 5KG |
| 11975 | Ammonium polysulphide solution approximately 10% w/v | 2.5L |
| 11976 | iso-Amyl acetate GPR | 2.5L |
| 11977 | iso-Amyl alcohol GPR | 500ML |
| 11978 | iso-Amyl alcohol GPR | 2.5L |
| 11979 | iso-Amyl nitrite GPR | 500ML |
| 11980 | Anthraquinone-2-sulphonic acid sodium salt 1-hydrate | 1KG |
| 11981 | Barium bromide GPR | 250G |
| 11982 | Barium carbonate GPR | 1KG |
| 11983 | Barium hydroxide GPR | 500G |
| 11984 | Barium peroxide GPR | 500G |
| 11985 | Benzotriazole GPR | 100G |
| 11986 | Boron trifluoride methanol complex | 500ML |
| 11987 | N-Bromosuccinimide GPR | 100G |
| 11988 | Brucine sulphate | 25G |
| 11989 | Butylated hydroxyanisole | 100G |
| 11990 | Cadmium granulated GPR about 3-6 mm | 250G |
| 11991 | Cadmium sulphate GPR | 500G |
| 11992 | Calcium granules GPR | 100G |
| 11993 | Calcium acetate dried GPR | 500G |
| 11994 | Calcium citrate GPR | 500G |
| 11995 | Calcium fluoride GPR | 500G |
| 11996 | Calcium gluconate GPR | 500G |
| 11997 | Calcium hydride GPR | 100G |
| 11998 | Calcium hydride GPR | 500G |
| 11999 | Calcium oxalate GPR | 500G |
| 12000 | Carboxymethylcellulose sodium salt low viscosity GPR | 500G |
| 12001 | Carminic acid purified | 5G |
| 12002 | Cetyltrimethylammonium bromide GPR | 500G |
| 12003 | Chloramine T GPR | 500G |
| 12004 | Chloroacetic acid GPR | 500G |
| 12005 | tetra-Chloroauric acid GPR about 50% Au (chloroauric | 1G |
| 12006 | 4-Chloro-m-cresol GPR (2-chloro-5-hydroxytoluene) | 500G |
| 12007 | Cobalt(II) hydroxide carbonate GPR | 250G |
| 12008 | Colchicine | 1G |
| 12009 | Cresol mixed isomers GPR | 2.5L |
| 12010 | Cetylpyridinium chloride GPR (1-hexadecylpyridinium | 100G |
| 12011 | Carboxymethylcellulose sodium salt high viscosity GP | 500G |
| 12012 | Ammonium bismuth citrate | 100G |
| 12013 | Citric acid anhydrous GPR | 500G |
| 12014 | iso-Amyl alcohol for the measurement of fat acc. to | 1L |
| 12015 | Calcium carbide GPR 0.8 mm-1.8 mm | 1KG |
| 12016 | n-Decane GPR | 500ML |
| 12017 | Devarda's alloy powder GPR about 45% Al 50% Cu and 5 | 500G |
| 12018 | Ethylenediaminetetra-acetic acid ferric monosodium s | 250G |
| 12019 | Ethylenediaminetetra-acetic acid dipotassium salt GP | 500G |
| 12020 | Ethylenediaminetetra-acetic acid tetrasodium salt GP | 250G |
| 12021 | Dimethyl phthalate GPR | 500ML |
| 12022 | n-Dodecane GPR | 100ML |
| 12023 | Propylene oxide GPR (1,2-epoxypropane) | 500ML |
| 12024 | Propylene oxide GPR (1,2-epoxypropane) | 2.5L |
| 12025 | Ethyl cellulose GPR (cellulose ethyl ether) | 250G |
| 12026 | Eugenol | 100ML |
| 12027 | Iron(III) citrate 3-hydrate (ferric citrate) | 500G |
| 12028 | Iron(III) nitrate 9-hydrate GPR (ferric nitrate) | 500G |
| 12029 | Fluorescein GPR (also for microscopy) | 250G |
| 12030 | Fluorescein sodium GPR (uranin) | 500G |
| 12031 | Formamide GPR | 2.5L |
| 12032 | Furfuraldehyde GPR | 500ML |
| 12033 | Glycerol triacetate GPR | 500ML |
| 12034 | Heparin Sodium | EACH |
| 12035 | Heparin Sodium | EACH |
| 12036 | Hexamine GPR (hexamethylenetetramine) | 500G |
| 12037 | Hydrogen bromide solution in glacial acetic acid abo | 500ML |
| 12038 | Indium sulphate | 25G |
| 12039 | Iodine chloride GPR | 25ML |
| 12040 | Iodine trichloride GPR | 25G |
| 12041 | trans-1, 2-Diaminocyclohexane-NNN'N'-tetra-acetic ac | 25G |
| 12042 | EGTA | 25G |
| 12043 | Imidazole extra pure GPR | 500G |
| 12044 | Iron(III) chloride 6-hydrate GPR (ferric chloride) | 1KG |
| 12045 | Sodium dichloroisocyanurate GPR | 500G |
| 12046 | Lecithin egg GPR | 100G |
| 12047 | Ligroin GPR | 2.5L |
| 12048 | Lithium powder | 25G |
| 12049 | Magnesium carbonate hydrated basic light GPR | 500G |
| 12050 | Magnesium carbonate hydrated basic heavy GPR | 500G |
| 12051 | Magnesium oxide light GPR | 500G |
| 12052 | Magnesium oxide heavy GPR | 500G |
| 12053 | Magnesium perchlorate dried GPR | 500G |
| 12054 | Maleic acid GPR | 1KG |
| 12055 | DL-Malic acid GPR | 500G |
| 12056 | Mannitol GPR | 500G |
| 12057 | Mannitol GPR | 2.5KG |
| 12058 | Mercurochrome | 25G |
| 12059 | Metaphosphoric acid GPR | 500G |
| 12060 | 2-Methoxyethanol GPR | 2.5L |
| 12061 | Metol GPR (4-methylaminophenol sulphate) | 500G |
| 12062 | dodeca-Molybdophosphoric acid GPR | 100G |
| 12063 | Naphthalene GPR | 500G |
| 12064 | N-1-Naphthylethylenediamine dihydrochloride GPR | 10G |
| 12065 | N-1-Naphthylethylenediamine dihydrochloride GPR | 100G |
| 12066 | n-Pentane GPR | 2.5L |
| 12067 | iso-Pentane GPR (2-methylbutane) | 500ML |
| 12068 | iso-Pentane GPR (2-methylbutane) | 2.5L |
| 12069 | Pentan-1-ol GPR | 2.5L |
| 12070 | DL-1-Phenylethanol GPR | 250ML |
| 12071 | Phenyl salicylate GPR | 250G |
| 12072 | Phloroglucinol GPR | 100G |
| 12073 | Pilocarpine hydrochloride GPR | 1G |
| 12074 | Pilocarpine nitrate GPR | 5G |
| 12075 | Polyethylene glycol average molecular weight 4000 | 500G |
| 12076 | Polyvinylpyrrolidone (PVP) | 500G |
| 12077 | tri-Potassium citrate GPR | 500G |
| 12078 | Potassium molybdate GPR | 100G |
| 12079 | Proflavine hemisulphate | 25G |
| 12080 | Pyrogallol GPR (1,2,3-trihydroxybenzene) | 500G |
| 12081 | Palladium/charcoal activated (10% Pd) | 10G |
| 12082 | Polyvinylpyrrolidone (PVP) | 250G |
| 12083 | Polypropylene glycol 2025 | 2.5L |
| 12084 | Polyvinyl alcohol | 500G |
| 12085 | Lithium metaborate 2-hydrate GPR | 100G |
| 12086 | 3-Methylbenzothiazol-2-one hydrazone hydrochloride G | 5G |
| 12087 | Lecithin soya bean | 100G |
| 12088 | Platinum wire 0.25mm (0.01 inch) suitable for use in | 60CM |
| 12089 | Orcinol GPR | 25G |
| 12090 | Lithium (metal rods) | 25G |
| 12091 | Quinine sulphate | 25G |
| 12092 | Silver acetate GPR | 100G |
| 12093 | Sodium sticks in paraffin GPR | 250G |
| 12094 | Sodium tetrachloroaurate (sodium chloroaurate) | 1G |
| 12095 | Sodium dithionite GPR | 500G |
| 12096 | Sodium fluoride GPR | 500G |
| 12097 | Sodium formate GPR | 500G |
| 12098 | Sodium b-glycerophosphate GPR | 250G |
| 12099 | di-Sodium hydrogen citrate 1.5-hydrate GPR | 500G |
| 12100 | Sodium periodate GPR (sodium metaperiodate) | 250G |
| 12101 | di-Sodium phosphite GPR (sodium phosphonate) | 250G |
| 12102 | Sodium propionate GPR | 500G |
| 12103 | tetra-Sodium pyrophosphate GPR | 1KG |
| 12104 | Sodium selenate GPR | 100G |
| 12105 | Sodium selenite 5-hydrate GPR | 100G |
| 12106 | Sodium silicate solution (water glass) | 2.5L |
| 12107 | Sodium starch glycollate | 25G |
| 12108 | Sodium succinate GPR | 500G |
| 12109 | Sodium sulphide GPR | 500G |
| 12110 | Sodium (+)-tartrate GPR | 500G |
| 12111 | Starch potato GPR | 1KG |
| 12112 | Starch wheat GPR | 1KG |
| 12113 | Stearic anhydride GPR | 100G |
| 12114 | Sulphur finely divided | 1KG |
| 12115 | n-Tetradecane GPR | 100ML |
| 12116 | Tetramethylammonium chloride GPR | 100G |
| 12117 | Toluene-4-sulphonic acid GPR | 500G |
| 12118 | 3,4,5-Trihydroxybenzoic acid GPR | 500G |
| 12119 | Triphenylphosphine GPR | 100G |
| 12120 | dodeca-Tungstophosphoric acid GPR | 500G |
| 12121 | dodeca-Tungstosilicic acid GPR | 500G |
| 12122 | Polyvinyl alcohol | 500G |
| 12123 | Yttrium nitrate | 10G |
| 12124 | *Triton X-100 | 500ML |
| 12125 | *Triton X-100 | 2.5L |
| 12126 | Stoddard solvent (ASTM D235 Type 1) [white spirit (B | 2.5L |
| 12127 | Sodium pellets in paraffin GPR | 250G |
| 12128 | *Triton X-100 USP grade | 2.5L |
| 12129 | Cobalt(II) chloride test papers for detection of wat | PK10 |
| 12130 | Acacia | 500G |
| 12131 | Albumen egg powder | 250G |
| 12132 | Anti-bumping granules | 250G |
| 12133 | Beeswax yellow | 500G |
| 12134 | Collodion flexible | 500ML |
| 12135 | Collodion for preparing permeable membranes | 500ML |
| 12136 | Collodion for preparing permeable membranes | 5L |
| 12137 | Kieselguhr white GPR | 1KG |
| 12138 | Kieselguhr white GPR | 5KG |
| 12139 | Methylene blue tablets for milk testing | PK50 |
| 12140 | Pumice stone granular particle size 5-7 mm | 500G |
| 12141 | Soda lime 'Carbosorb' brand (non-deliquescent) size | 500G |
| 12142 | Soda lime 'Carbosorb' brand (non-deliquescent) self- | 500G |
| 12143 | Soda lime 'Carbosorb' brand (non-deliquescent) self- | 500G |
| 12144 | Soda lime 'Carbosorb' brand (non-deliquescent) self | 500G |
| 12145 | *'Celite' analytical filter aid | 25G |
| 12146 | Buffer tablets pH 4.00 0.02 | PK50 |
| 12147 | Buffer tablets pH 7.00 0.02 | PK50 |
| 12148 | Buffer tablets pH 9.22 0.02 | PK50 |
| 12149 | 'Carbosorb AS' granules size 2.8-5.6 mm (3-6 mesh) | 500G |
| 12150 | 'Carbosorb AS' granules size 1.4-2.8 mm (6-12 mesh) | 500G |
| 12151 | 'Carbosorb AS' granules size 0.78-1.4 mm (12-20 mesh | 500G |
| 12152 | Dimethyldichlorosilane solution about 2% in 1,1,1- t | 500ML |
| 12153 | Dimethyldichlorosilane solution about 2% in 1,1,1- t | 2.5L |
| 12154 | Buffer tablets 'Gurr' pH approximately 6.8 | PK50 |
| 12155 | Buffer tablets 'Gurr' pH approximately 9.2 | PK50 |
| 12156 | Buffer tablets 'Gurr' pH approximately 7.0 | PK50 |
| 12157 | Glass balls 5.5 to 6.5 mm | 500G |
| 12158 | Glass balls 4.5 to 5.5 mm | 500G |
| 12159 | Glass balls 3.5 to 4.5 mm | 500G |
| 12160 | Glass balls 2.5 to 3.5 mm | 500G |
| 12161 | Glass balls 1.5 to 2 mm | 500G |
| 12162 | Hyflo supercel filter-aid | 500G |
| 12163 | Decon autoclave deodoriser capsules | PK100 |
| 12164 | Decon autoclave deodoriser capsules | PK500 |
| 12165 | Lysol | 5L |
| 12166 | Acridine orange 'Gurr' 'Certistain' for microscopica | 25G |
| 12167 | Aniline blue (water soluble) &ss 'Gurr' for microsco | 25G |
| 12168 | Azur II &ss 'Gurr' for microscopical staining | 25G |
| 12169 | Biebrich scarlet (water soluble) &ss 'Gurr for micro | 25G |
| 12170 | Bismarck brown R &ss 'Gurr' for microscopical staini | 25G |
| 12171 | Blue tetrazolium | 5G |
| 12172 | Brilliant green 'Gurr' for bacteriological use | 500G |
| 12173 | Carbol fuchsin powder 'Gurr' for microscopical stain | 25G |
| 12174 | Carmine 'Gurr' 'Certistain' for microscopical staini | 25G |
| 12175 | Celestine blue B 'Gurr' For microscopical staining | 10G |
| 12176 | Chromotrope 2R 'Gurr' for microscopical staining | 25G |
| 12177 | Congo red 'Gurr' for microscopical staining | 25G |
| 12178 | Crystal violet 'Gurr' 'Certistain' for microscopical | 25G |
| 12179 | Crystal violet 'Gurr' 'Certistain' for microscopical | 100G |
| 12180 | Eosin bluish 'Gurr' 'Certistain' for microscopical s | 25G |
| 12181 | Eosin (spirit soluble) &ss 'Gurr' for microscopical | 25G |
| 12182 | Erythrosin B 'Gurr' 'Certistain' | 25G |
| 12183 | Fast green FCF 'Gurr' 'Certistain' for microscopical | 25G |
| 12184 | Fuchsin (basic) 'Gurr' 'Certistain' for microscopica | 25G |
| 12185 | Fuchsin (basic) 'Gurr' 'Certistain' for microscopica | 100G |
| 12186 | Methyl violet 'Gurr' 'Certistain' for microscopical | 25G |
| 12187 | Giemsa's stain 'Gurr' for microscopical staining | 25G |
| 12188 | Giemsa's stain 'Gurr' for microscopical staining | 100G |
| 12189 | Gram's iodine 'Gurr' for microscopical staining | 25G |
| 12190 | Haematein &ss 'Gurr' for microscopical staining | 25G |
| 12191 | Haematoxylin (monohydrate) 'Gurr' 'Certistain' for m | 25G |
| 12192 | Haematoxylin (monohydrate) 'Gurr' 'Certistain' for m | 100G |
| 12193 | Indigo carmine 'Gurr' 'Certistain' for microscopical | 25G |
| 12194 | 2-(4-Iodophenyl)-3-(4-nitrophenyl)- 5-phenyltetrazol | 5G |
| 12195 | Janus green (diazine green)_ for microscopical stain | 10G |
| 12196 | Leishman's stain (eosin methylene blue compound) 'Gu | 25G |
| 12197 | Luxol fast blue MBS 'Gurr' for microscopical stainin | 25G |
| 12198 | Malachite green (oxalate) 'Gurr' 'Certistain' for mi | 25G |
| 12199 | Malachite green (oxalate) 'Gurr' 'Certistain' for mi | 100G |
| 12200 | May and Grunwald's stain &ss 'Gurr' for microscopy | 25G |
| 12201 | Methyl blue Gurr (Water blue 6B extra P) for microsc | 25G |
| 12202 | Methylene blue 'Gurr' 'Certistain' for staining and | 25G |
| 12203 | Methylene blue 'Gurr' 'Certistain' for staining and | 100G |
| 12204 | Naphthol green B 'Gurr' for microscopical staining | 25G |
| 12205 | Neutral red 'Gurr' 'Certistain' for microscopical st | 25G |
| 12206 | Neutral red 'Gurr' 'Certistain' for microscopical st | 100G |
| 12207 | Nigrosine (water soluble) 'Gurr' 'Certistain' for mi | 25G |
| 12208 | Nile blue (hydrogen sulphate) 'Gurr' 'Certistain' fo | 25G |
| 12209 | Nitro blue tetrazolium | 0.25G |
| 12210 | Nitro blue tetrazolium | 1G |
| 12211 | Orange G 'Gurr' 'Certistain' for microscopical stain | 25G |
| 12212 | Orange G 'Gurr' 'Certistain' for microscopical stain | 100G |
| 12213 | Phloxin B 'Gurr' 'Certistain' for microscopical stai | 25G |
| 12214 | Ruthenium red (ruthenium oxychloride ammoniated) &ss | 0.1G |
| 12215 | Sudan II 'Gurr' for microscopical staining | 25G |
| 12216 | Sudan III &ss 'Gurr' for microscopical staining | 25G |
| 12217 | Sudan IV &ss 'Gurr' (Scarlet R Michaelis) | 25G |
| 12218 | Tetrazolium salt (2,3, 5-triphenyltetrazolium chlori | 10G |
| 12219 | Tetrazolium salt (2,3, 5-triphenyltetrazolium chlori | 25G |
| 12220 | Tetrazolium salt (2,3, 5-triphenyltetrazolium chlori | 100G |
| 12221 | Thiazolyl blue (MTT) | 1G |
| 12222 | Thionine (acetate) 'Gurr' 'Certistain' for microscop | 25G |
| 12223 | Toluidine blue 'Gurr' 'Certistain' for microscopical | 25G |
| 12224 | Trypan blue 'Gurr' for vital staining | 25G |
| 12225 | Victoria blue B 'Gurr' for microscopical staining | 25G |
| 12226 | Wright's stain 'Gurr' for microscopical staining | 25G |
| 12227 | Xylidine ponceau &ss for microscopical staining | 25G |
| 12228 | Alkali blue 6B 'Gurr' stain and indicator for non- a | 25G |
| 12229 | Auramine O 'Gurr' | 25G |
| 12230 | Auramine O 'Gurr' | 100G |
| 12231 | Waxoline blue 'Gurr' | 25G |
| 12232 | Berlin blue soluble 'Gurr' | 25G |
| 12233 | Bismarck brown Y 'Gurr' | 25G |
| 12234 | Eriochrome blue black SE metal indicator | 25G |
| 12235 | Erythrosin Y 'Gurr' (di-iodo(R)fluorescein) | 25G |
| 12236 | Ethyl violet 'Gurr' | 25G |
| 12237 | Evans blue 'Gurr' | 25G |
| 12238 | Fast blue B salt (zinc chloride double salt) | 25G |
| 12239 | Fast blue BB salt 'Gurr' | 25G |
| 12240 | Fast red B salt 'Gurr' | 25G |
| 12241 | Field's stain A 'Gurr' | 25G |
| 12242 | Field's stain B 'Gurr' | 25G |
| 12243 | Gallocyanine 'Gurr' | 25G |
| 12244 | Harris's haematoxylin 'Gurr' | 25G |
| 12245 | Harris's haematoxylin 'Gurr' | 100G |
| 12246 | Martius yellow 'Gurr' | 25G |
| 12247 | Patent blue V (VF) sodium salt 'Gurr' | 25G |
| 12248 | Ponceau S 'Gurr' 'Certistain' for microscopical stai | 25G |
| 12249 | Ponceau de xylidine 'Gurr' (acid red 26 'Food' red 5 | 25G |
| 12250 | Pontamine sky blue 5BX 'Gurr' | 25G |
| 12251 | Pontamine sky blue 6BX 'Gurr' | 25G |
| 12252 | Rhodamine B 'Gurr' | 25G |
| 12253 | Rose bengal 'Gurr' | 25G |
| 12254 | Saffron 'Gurr' | 10G |
| 12255 | Saffron 'Gurr' | 25G |
| 12256 | Sirius red F3B 'Gurr' | 25G |
| 12257 | Tartrazine 'Gurr' | 25G |
| 12258 | Thioflavine T 'Gurr' | 25G |
| 12259 | Carmoisine A 'Gurr' | 25G |
| 12260 | Fast red TR salt 'Gurr' | 10G |
| 12261 | Ponceau 3R 'Gurr' | 10G |
| 12262 | Ponceau fuchsin (Masson) 'Gurr' | 25G |
| 12263 | Sudan blue 'Gurr' | 25G |
| 12264 | Astra blue for histology and histochemistry | 25G |
| 12265 | New methylene blue zinc chloride | 25G |
| 12266 | Eosin yellowish 'Gurr' 'Certistain' for microscopica | 25G |
| 12267 | Eosin yellowish 'Gurr' 'Certistain' for microscopica | 100G |
| 12268 | Sudan black B 'Gurr' 'Certistain' for microscopical | 25G |
| 12269 | Leucomalachite green 'Gurr' | 10G |
| 12270 | Light green SF 'Gurr' 'Certistain' for microscopical | 25G |
| 12271 | Methyl green 'Gurr' 'Certistain' for microscopical s | 25G |
| 12272 | Pyronine G 'Gurr' 'Certistain' for microscopical sta | 25G |
| 12273 | Brilliant cresyl blue 'Gurr' 'Certistain' for micros | 25G |
| 12274 | Azur B (tetrafluoroborate) 'Gurr' 'Certistain' for m | 10G |
| 12275 | Nuclear fast red 'Gurr' 'Certistain' for microscopic | 25G |
| 12276 | Orcein synthetic 'Gurr' 'Certistain' for microscopic | 5G |
| 12277 | Orcein synthetic 'Gurr' 'Certistain' for microscopic | 25G |
| 12278 | Brilliant green (hydrogen sulphate) 'Gurr' 'Certista | 25G |
| 12279 | Safranine O 'Gurr' 'Certistain' for microscopical st | 25G |
| 12280 | Oil red O 'Gurr' 'Certistain' for microscopical stai | 25G |
| 12281 | Alizarin red S 'Gurr' 'Certistain' for microscopical | 25G |
| 12282 | Silver proteinate improved 'Gurr' | 25G |
| 12283 | Pararosaniline chloride 'Gurr' 'Certistain' for micr | 25G |
| 12284 | Fuchsin (acid) 'Gurr' 'Certistain' | 25G |
| 12285 | Congo red 'Gurr' 'Certistain' | 25G |
| 12286 | New fuchsin 'Gurr' 'Certistain' for microscopical st | 25G |
| 12287 | Cresyl violet acetate 'Gurr' 'Certistain' | 25G |
| 12288 | Alcian blue 8GX 'Gurr' 'Certistain' | 25G |
| 12289 | Elastin stain (Miller) (formulation Raymond A. Lamb) | 500ML |
| 12290 | Canada balsam filtered for microscopy | 100ML |
| 12291 | DPX mountant for microscopy | 100ML |
| 12292 | DPX mountant for microscopy | 500ML |
| 12293 | Indian ink (liquid non water proof) | 30ML |
| 12294 | Oil of cloves (redistilled and dried) | 500ML |
| 12295 | Xylene low in sulphur special for microscopical work | 2.5L |
| 12296 | Lenzol immersion oil 'Gurr' | 100ML |
| 12297 | 'Paramat' pastillated 'Gurr' | 2.5 KG |
| 12298 | 'ERADA-STAIN' Cream biological stain remover | 6 OZ |
| 12299 | 'ERADO-SOL' liquid biological stain remover | 32 OZ |
| 12300 | DePeX mounting medium 'Gurr' | 100ML |
| 12301 | DePeX mounting medium 'Gurr' | 500ML |
| 12302 | 'Paramat extra' pastillated 'Gurr' | 2.5KG |
| 12303 | Osmium tetraoxide (osmic acid) 'Gurr' for electron m | 0.1G |
| 12304 | Osmium tetraoxide (osmic acid) 'Gurr' for electron m | 0.5G |
| 12305 | Osmium tetraoxide (osmic acid) 'Gurr' for electron m | 1G |
| 12306 | L-Alanine dextro-rotatory chromatographically homoge | 100G |
| 12307 | L-Alanine dextro-rotatory chromatographically homoge | 500G |
| 12308 | L-Arginine monohydrochloride chromatographically hom | 500G |
| 12309 | L-Asparagine | 500G |
| 12310 | L-Aspartic acid chromatographically homogeneous | 500G |
| 12311 | Creatinine | 25G |
| 12312 | Creatinine zinc chloride 99/100% (standard for creat | 100G |
| 12313 | L-Cysteine hydrochloride 1-hydrate | 100G |
| 12314 | L-Cystine | 500G |
| 12315 | DL-Glutamic acid anhydrous | 100G |
| 12316 | L-Glutamic acid sodium salt | 500G |
| 12317 | L-Histidine monohydrochloride chromatographically ho | 100G |
| 12318 | L-Histidine monohydrochloride chromatographically ho | 500G |
| 12319 | L-Leucine | 100G |
| 12320 | L-iso-Leucine | 100G |
| 12321 | L-Methionine | 100G |
| 12322 | DL-Methionine | 1KG |
| 12323 | L-Threonine chromatographically homogeneous | 100G |
| 12324 | L-Tryptophan chromatographically homogeneous | 100G |
| 12325 | DL-Tryptophan chromatographically homogeneous | 100G |
| 12326 | L-Tyrosine chromatographically homogeneous | 500G |
| 12327 | L-Arginine chromatographically homogeneous | 250G |
| 12328 | L-Cysteine | 100G |
| 12329 | L-Histidine | 250G |
| 12330 | Aesculin | 25G |
| 12331 | D(-)-Arabinose | 100G |
| 12332 | L(+) Arabinose | 100G |
| 12333 | Cellobiose | 25G |
| 12334 | Dextran Grade B | 100G |
| 12335 | Dextran Grade C | 100G |
| 12336 | Inositol (meso) inactive | 100G |
| 12337 | D(+)Mannose | 25G |
| 12338 | D(+)Melibiose | 10G |
| 12339 | Salicin | 10G |
| 12340 | Xylitol | 100G |
| 12341 | Glucotropaeolin Potassium Salt Biochemical | 100MG |
| 12342 | Diastase from malt (mixed a and b amylase) | 100G |
| 12343 | Hyaluronidase from bovine testes (3.2.1.35) | 0.1G |
| 12344 | Invertase concentrate from yeast stabilized with gly | 100ML |
| 12345 | Lysozyme crystalline from egg white (3.2.1.17) | 1G |
| 12346 | Neuraminidase from Vibrio cholerae (3.2.1.18) | 1ML |
| 12347 | Pancreatin from pig pancreas | 250G |
| 12348 | Papain (from carica papaya) water soluble (3.4.22.2) | 100G |
| 12349 | Pepsin A powder (3.4.23.1) (formerly 3.4.4.1) | 250G |
| 12350 | Cellulase from Trichoderma viride (3.2.1.4) | 10G |
| 12351 | Cellulase from Trichoderma viride (3.2.1.4) | 50G |
| 12352 | Proteinase K (fungal) (3.4.21.14) chromatographicall | 25MG |
| 12353 | Proteinase K (fungal) (3.4.21.14) chromatographicall | 0.1G |
| 12354 | Proteinase K (fungal) (3.4.21.14) chromatographicall | 0.5G |
| 12355 | Proteinase K (fungal) (3.4.21.14) chromatographicall | 10G |
| 12356 | Diastase from pig pancreas | 25G |
| 12357 | Catalase from bovine liver suspension in water (stab | EACH |
| 12358 | Proteinase K immobilised | 1ML |
| 12359 | Proteinase K solution | 10ML |
| 12360 | S-Acetylthiocholine iodide | 10G |
| 12361 | Adenosine-5'-triphosphoric acid disodium dihydrogen | 5G |
| 12362 | Choline chloride | 100G |
| 12363 | Choline chloride | 500G |
| 12364 | Adenosine-5'-monophosphoric acid disodium salt (AMP) | 5G |
| 12365 | Guanidinium chloride molecular biology grade | 100G |
| 12366 | Guanidinium chloride molecular biology grade | 1KG |
| 12367 | N-2-Hydroxyethylpiperazine-N'-2- ethanesulphonic aci | 25G |
| 12368 | N-2-Hydroxyethylpiperazine-N'-2- ethanesulphonic aci | 250G |
| 12369 | 2-Mercaptoethanol molecular biology grade | 50ML |
| 12370 | 2-Mercaptoethanol molecular biology grade | 250ML |
| 12371 | Polyvinylpyrrolidone (PVP) molecular biology grade | 100G |
| 12372 | Polyvinylpyrrolidone (PVP) molecular biology grade | 1KG |
| 12373 | Piperazine-NN'-bis-2-ethanesulphonic acid (PIPES) mo | 25G |
| 12374 | Piperazine-NN'-bis-2-ethanesulphonic acid (PIPES) mo | 250G |
| 12375 | Potassium dihydrogen orthophosphate molecular biolog | 250G |
| 12376 | Potassium dihydrogen orthophosphate molecular biolog | 1KG |
| 12377 | di-Potassium hydrogen orthophosphate 3-hydrate molec | 250G |
| 12378 | di-Potassium hydrogen orthophosphate 3-hydrate molec | 1KG |
| 12379 | tri-Sodium citrate molecular biology grade | 100G |
| 12380 | tri-Sodium citrate molecular biology grade | 1KG |
| 12381 | Tris(hydroxymethyl) methylammonium chloride molecula | 100G |
| 12382 | Tris(hydroxymethyl) methylammonium chloride molecula | 1KG |
| 12383 | Instaview Universal | 1L |
| 12384 | Blotting membrane nitrocellulose (0.45mm) 'Electran' | EACH |
| 12385 | Blotting membrane nitrocellulose (0.45mm) 'Electran' | EACH |
| 12386 | Blotting membrane nitrocellulose (0.45mm) 'Electran' | EACH |
| 12387 | Blotting membrane nitrocellulose (0.45mm) 'Electran' | EACH |
| 12388 | Blotting membrane nitrocellulose (0.45mm) 'Electran' | EACH |
| 12389 | Blotting membrane supported nitrocellulose (0.45mm) | PK50 |
| 12390 | Blotting membrane supported nitrocellulose (0.45mm) | PK50 |
| 12391 | Blotting membrane supported nitrocellulose (0.45mm) | PK50 |
| 12392 | Blotting membrane supported nitrocellulose (0.45mm) | PK10 |
| 12393 | Blotting membrane supported nitrocellulose (0.45mm) | EACH |
| 12394 | Blotting membrane nylon 'Electran' in circles | PK50 |
| 12395 | Blotting membrane nylon 'Electran' in circles | PK50 |
| 12396 | Blotting membrane nylon 'Electran' in circles | PK50 |
| 12397 | Blotting membrane nylon 'Electran' in roll form | EACH |
| 12398 | Blotting membrane nylon 'Electran' in circles | PK50 |
| 12399 | Blotting membrane optimized nylon 'Electran' in circ | PK50 |
| 12400 | Blotting membrane optimized nylon 'Electran' in circ | PK50 |
| 12401 | Blotting membrane optimized nylon 'Electran' in circ | PK50 |
| 12402 | Blotting membrane optimized nylon 'Electran' in roll | EACH |
| 12403 | Blotting membrane optimized nylon 'Electran' in circ | PK50 |
| 12404 | Isoelectric Point Markers pI Calibration Kit 'Electr | EACH |
| 12405 | Mol. Wt Markers calib.kit for M.W. detn in (non-SDS) | KIT |
| 12406 | Saponin white suitable for haemolysis | 100G |
| 12407 | 'Gel in a bottle' 6T 5C DNA sequencing | 500ML |
| 12408 | 'Gel in a bottle' 6T 5C DNA sequencing | 1L |
| 12409 | Instaview Silver Staining Kit | PK10 |
| 12410 | Agarose high resolution 'Electran' | 25G |
| 12411 | Instaview Nitrocellulose | KIT |
| 12412 | Blotting transfer membrane PVDF 'Electran' in sheet | EACH |
| 12413 | Blotting transfer membrane PVDF 'Electran' in roll f | EACH |
| 12414 | Blotting transfer membrane PVDF 'Electran' in roll f | EACH |
| 12415 | Blotting membrane supported nitrocellulose (0.2 mm) | EACH |
| 12416 | Blotting membrane, supported nitrocellulose (0.2 Um) | EACH |
| 12417 | Blotting membrane, supported nitrocellulose (0.2 mm) | EACH |
| 12418 | Blotting membrane nitrocellulose (0.2 mm) 'Electran' | PK20 |
| 12419 | Blotting membrane nitrocellulose (0.2 mm) 'Electran' | EACH |
| 12420 | Blotting membrane nitrocellulose (0.2 mm) 'Electran' | EACH |
| 12421 | Blotting membrane positively charged nylon 'Electran | EACH |
| 12422 | Blotting membrane positively charged nylon 'Electran | EACH |
| 12423 | Blotting membrane positively charged nylon 'Electran | EACH |
| 12424 | Blotting membrane positively charged nylon 'Electran | EACH |
| 12425 | Blotting membrane positively charged nylon 'Electran | EACH |
| 12426 | Sodium dodecyl sulphate 'Electran' | 100G |
| 12427 | 'Resolyte' 2-5 | 5ML |
| 12428 | 'Resolyte' 2-5 | 25ML |
| 12429 | *Polyclar SB100 (polyvinylpyrrolidone insoluble) | 100G |
| 12430 | Coomassie violet R-150 'Electran' | 25G |
| 12431 | Phenol redistilled molecular biology grade | 100G |
| 12432 | Phenol redistilled molecular biology grade | 500G |
| 12433 | Zinc chloride molecular biology grade | 50G |
| 12434 | Magnesium chloride hexahydrate molecular biology gra | 100G |
| 12435 | Magnesium chloride hexahydrate molecular biology gra | 500G |
| 12436 | *Triton X-100 molecular biology grade | 50ML |
| 12437 | EGTA molecular biology grade | 10G |
| 12438 | EGTA molecular biology grade | 25G |
| 12439 | Potassium chloride molecular biology grade | 250G |
| 12440 | Potassium chloride molecular biology grade | 1KG |
| 12441 | Magnesium sulphate heptahydrate molecular biology gr | 100G |
| 12442 | Magnesium sulphate heptahydrate molecular biology gr | 500G |
| 12443 | Calcium chloride 2-hydrate molecular biology grade | 250G |
| 12444 | Calcium chloride 2-hydrate molecular biology grade | 1KG |
| 12445 | Potassium acetate molecular biology grade | 250G |
| 12446 | Potassium acetate molecular biology grade | 1KG |
| 12447 | Ammonium chloride molecular biology grade | 250G |
| 12448 | Ammonium chloride molecular biology grade | 1KG |
| 12449 | *'Tween' 20 molecular biology grade | 100ML |
| 12450 | *Ficoll 400 molecular biology grade | 25G |
| 12451 | *Ficoll 400 molecular biology grade | 250G |
| 12452 | Guanidinium thiocyanate molecular biology grade | 25G |
| 12453 | Guanidinium thiocyanate molecular biology grade | 250G |
| 12454 | DNA Herring sperm sonicated molecular biology grade | 10MG |
| 12455 | DNA Herring sperm sonicated molecular biology grade | 100MG |
| 12456 | RNase inhibitor recombinant molecular biology grade | EACH |
| 12457 | Propan-2-ol(Iso-propanol) Molecular Biology Grade | 250ML |
| 12458 | G-418 Sulphate molecular biology grade | 1G |
| 12459 | Ammonium acetate molecular biology grade | 250G |
| 12460 | Formaldehyde Solution 37% Mol Biol Grade | 250ML |
| 12461 | Formaldehyde Solution 37% Mol Biol Grade | 2.5L |
| 12462 | Cytochrome C from horse heart for biochemistry | 100MG |
| 12463 | X-Glca Cyclohexylammonium Salt Mol Biol Grade | 100MG |
| 12464 | X-Glca Cyclohexylammonium Salt Mol Biol Grade | 1G |
| 12465 | Xylene Cyanol, CI 42135 'Electran' | 25G |
| 12466 | Albumin crystallized bovine | 1G |
| 12467 | Albumin crystallized bovine | 5G |
| 12468 | L-Ascorbic acid (vitamin C) | 100G |
| 12469 | L-Ascorbic acid (vitamin C) | 500G |
| 12470 | D-Biotin crystalline | 1G |
| 12471 | Casein for nutrition experiments soluble light white | 500G |
| 12472 | Casein for nutrition experiments soluble light white | 2.5KG |
| 12473 | Casein fat free and low in vitamins | 500G |
| 12474 | Casein (Hammarsten) | 100G |
| 12475 | Casein (Hammarsten) | 1KG |
| 12476 | Casein hydrolysate for bacteriological use not vitam | 500G |
| 12477 | Cyanocobalamin (vitamin B12) | 1G |
| 12478 | Folic acid | 100G |
| 12479 | Histamine acid phosphate | 5G |
| 12480 | Histamine acid phosphate | 25G |
| 12481 | Nicotinamide | 100G |
| 12482 | Nicotinic acid | 100G |
| 12483 | (+)-Pantothenic acid calcium salt | 100G |
| 12484 | Peptone bacteriological BDH | 500G |
| 12485 | Ponceau S 'Electran' | 25G |
| 12486 | Pyridoxine hydrochloride (vitamin B6) | 25G |
| 12487 | Riboflavin 'Electran' | 25G |
| 12488 | Saponin | 500G |
| 12489 | Sodium pyruvate | 100G |
| 12490 | Sodium pyruvate | 2.5KG |
| 12491 | Zein | 500G |
| 12492 | NN-Bis(2-hydroxyethyl)glycine ('bicine') | 100G |
| 12493 | NN-Bis(2-hydroxyethyl)glycine ('bicine') | 1KG |
| 12494 | NN-Bis(2-hydroxyethyl)glycine ('bicine') | 5KG |
| 12495 | N-Tris(hydroxymethyl)methylglycine ('tricine') | 100G |
| 12496 | N-Tris(hydroxymethyl)methylglycine ('tricine') | 1KG |
| 12497 | N-(2-Acetamido)-2-aminoethanesulphonic acid (ACES) | 100G |
| 12498 | NN-Bis(2-hydroxyethyl)-2-aminoethane sulphonic acid | 250G |
| 12499 | 2-Mercaptoethanol | 25ML |
| 12500 | 2-Mercaptoethanol | 100ML |
| 12501 | 2-Mercaptoethanol | 500ML |
| 12502 | Dithiothreitol (Cleland's reagent) | 5G |
| 12503 | Dithiothreitol (Cleland's reagent) | 25G |
| 12504 | Albumin bovine fraction V | 25G |
| 12505 | Albumin bovine fraction V | 100G |
| 12506 | Ethidium bromide 'Electran' | 1G |
| 12507 | Ethidium bromide 'Electran' | 5G |
| 12508 | Diethyl pyrocarbonate | 25ML |
| 12509 | Mitomycin C | 2MG |
| 12510 | Benzylpenicillin potassium salt (penicillin G potass | 25G |
| 12511 | Chloramphenicol | 5G |
| 12512 | Neomycin sulphate | 25G |
| 12513 | Novobiocin sodium salt | 5G |
| 12514 | Nystatin | 5G |
| 12515 | Sodium dodecyl sulphate specially purified for bioch | 100G |
| 12516 | Sodium dodecyl sulphate specially purified for bioch | 1KG |
| 12517 | NN'-Diallyltartardiamide 'Electran' (DATD) | 25G |
| 12518 | Bis(2-hydroxyethyl)-(iminotris) (hydroxymethyl)metha | 25G |
| 12519 | Lithium dodecyl sulphate (lithium lauryl sulphate) | 25G |
| 12520 | Molecular Weight Markers for SDS electrophoresis 'El | 2MG |
| 12521 | Agarose 25 'Electran' | 25G |
| 12522 | Agarose 25 'Electran' | 100G |
| 12523 | Agarose 10 'Electran' | 25G |
| 12524 | Formamide specially purified for biochemistry deioni | 100ML |
| 12525 | Acrylogel 5 Premix 'Electran' | 250G |
| 12526 | Acrylogel 5 Premix 'Electran' 'Safe-Break' | 207G |
| 12527 | Molecular Weight Markers SDS electrophoresis 'Electr | 2MG |
| 12528 | Polyethylene glycol 6000 for biochemistry | 500G |
| 12529 | Polyethylene glycol 4000 for biochemistry | 500G |
| 12530 | Isoelectric Point Markers pI Calibration Kit 'Electr | EACH |
| 12531 | Silane A-174 'Electran' | 25ML |
| 12532 | Naphthalene black 12B 'Electran' (Amido black 10B) | 25G |
| 12533 | Starch hydrolysed (Smithies) 'Electran' | 100G |
| 12534 | Starch hydrolysed (Smithies) 'Electran' | 1KG |
| 12535 | Acrylamide 'Electran' | 250G |
| 12536 | Acrylamide 'Electran' | 1KG |
| 12537 | NN'-Methylenebisacrylamide 'Electran' | 25G |
| 12538 | NN'-Methylenebisacrylamide 'Electran' | 100G |
| 12539 | NN'-Methylenebisacrylamide 'Electran' | 500G |
| 12540 | Agarose 15 'Electran' | 25G |
| 12541 | Agarose 15 'Electran' | 100G |
| 12542 | Agarose 15 'Electran' | 500G |
| 12543 | 3-Dimethylaminopropionitrile 'Electran' (2-dimethyla | 25ML |
| 12544 | Bromophenol blue 'Electran' | 10G |
| 12545 | Ammonium peroxodisulphate 'Electran' (ammonium persu | 25G |
| 12546 | Ammonium peroxodisulphate 'Electran' (ammonium persu | EACH |
| 12547 | NNN'N'-Tetramethylethylenediamine (TEMED) 'Electran' | 25ML |
| 12548 | Acrylamide grade 1 'Electran' molecular biology grad | 100G |
| 12549 | Acrylamide grade 1 'Electran' molecular biology grad | 500G |
| 12550 | Acrylamide grade 1 'Electran' molecular biology grad | 2KG |
| 12551 | Acrylamide grade 1 'Electran' molecular biology grad | 25KG |
| 12552 | Agarose IEF 'Electran' | 25G |
| 12553 | Guanidinium thiocyanate specially purified for bioch | 250G |
| 12554 | Isoelectric Point Markers pI Calibration Kit 'Electr | EACH |
| 12555 | Coomassie brilliant blue R-250 | 10G |
| 12556 | Coomassie brilliant blue R-250 | 25G |
| 12557 | Coomassie brilliant blue G-250 | 10G |
| 12558 | Coomassie brilliant blue G-250 | 25G |
| 12559 | Acrylogel 2.6 Premix 'Electran' ' Safe-Break' | 207G |
| 12560 | Acrylogel 2.6 Premix 'Electran' | 250G |
| 12561 | Acrylogel 2.6 Premix 'Electran' 'Safe-Break' | 41.5G |
| 12562 | Acrylogel 3 Premix 'Electran' | 250G |
| 12563 | Acrylogel 3 Premix 'Electran' 'Safe-Break' | 207G |
| 12564 | Acrylogel 3 Premix 'Electran' 'Safe-Break' | 41.5G |
| 12565 | 'Resolyte' 3.5-10 | 5ML |
| 12566 | 'Resolyte' 3.5-10 | 25ML |
| 12567 | 'Resolyte' 3.5-10 | 100ML |
| 12568 | 'Resolyte' 4-8 | 5ML |
| 12569 | 'Resolyte' 4-8 | 25ML |
| 12570 | 'Resolyte' 4-8 | 100ML |
| 12571 | 'Resolyte' 3-6.5 | 5ML |
| 12572 | 'Resolyte' 3-6.5 | 25ML |
| 12573 | 'Resolyte' 3-6.5 | 100ML |
| 12574 | Acrylamide 'Electran' routine grade | 1KG |
| 12575 | SSC Buffer (20 x concentrate) | 2.5L |
| 12576 | SSC Buffer (20 x concentrate) (Bag in box) | 10L |
| 12577 | Denhardt's reagent,vial | EACH |
| 12578 | Acrylamide solution (40% w/v) 'Electran' 'Safe-Break | 1L |
| 12579 | NN'-Methylenebisacrylamide solution (2% w/v) 'Electr | 1L |
| 12580 | Molecular Weight Markers calibration kit for SDS pol | 2MG |
| 12581 | Agarose 'Electran' molecular biology grade | 100G |
| 12582 | Agarose 'Electran' molecular biology grade | 25G |
| 12583 | Agarose 'Electran' molecular biology grade | 250G |
| 12584 | Isoelectric Point Markers pI Calibration Kit for den | EACH |
| 12585 | Acrylogel 5 solution 'Electran' 'Safe-Break' | 1L |
| 12586 | Acrylogel 3 solution 'Electran' 'Safe-Break' | 1L |
| 12587 | Acrylogel 2.6 solution 'Electran' 'Safe-Break' | 1L |
| 12588 | Caesium chloride molecular biology grade | 100G |
| 12589 | Caesium chloride molecular biology grade | 1KG |
| 12590 | NN'-Methylenebisacrylamide 'Electran' molecular biol | 25G |
| 12591 | NN'-Methylenebisacrylamide 'Electran' molecular biol | 100G |
| 12592 | Sucrose molecular biology grade | 500G |
| 12593 | Sodium chloride molecular biology grade | 500G |
| 12594 | Sodium chloride molecular biology grade | 5KG |
| 12595 | 3-(N-Morpholino)propanesulphonic acid (MOPS) molecul | 100G |
| 12596 | Water molecular biology grade (Bag in box) | 10L |
| 12597 | Dithiothreitol (Cleland's reagent) molecular biology | 1G |
| 12598 | Dithiothreitol (Cleland's reagent) molecular biology | 5G |
| 12599 | Dithiothreitol (Cleland's reagent) molecular biology | 10G |
| 12600 | Tris(hydroxymethyl)methylamine 'Electran' molecular | 500G |
| 12601 | Tris(hydroxymethyl)methylamine 'Electran' molecular | 2.5KG |
| 12602 | Urea 'Electran' molecular biology grade | 100G |
| 12603 | Urea 'Electran' molecular biology grade | 500G |
| 12604 | Urea 'Electran' molecular biology grade | 2.5KG |
| 12605 | Urea 'Electran' molecular biology grade | 5KG |
| 12606 | Ethylenediaminetetra-acetic acid disodium salt molec | 100G |
| 12607 | Ethylenediaminetetra-acetic acid disodium salt molec | 1KG |
| 12608 | Sodium acetate anhydrous molecular biology grade | 500G |
| 12609 | Sodium acetate anhydrous molecular biology grade | 5KG |
| 12610 | Orthoboric acid molecular biology grade | 500G |
| 12611 | Orthoboric acid molecular biology grade | 1KG |
| 12612 | Orthoboric acid molecular biology grade | 5KG |
| 12613 | Polyethylene glycol 6000 molecular biology grade | 100G |
| 12614 | Polyethylene glycol 6000 molecular biology grade | 1KG |
| 12615 | Ethidium bromide solution 'Electran' 10mg/ml solutio | 10ML |
| 12616 | Pre-stained protein markers for SDS polyacrylamide g | EACH |
| 12617 | 'Resolyte' 6-9.5 | 5ML |
| 12618 | 'Resolyte' 6-9.5 | 25ML |
| 12619 | 'Resolyte' 6-9.5 | 100ML |
| 12620 | SSPE buffer 'Electran' (20'concentrate) | 1L |
| 12621 | SDS PAGE tank buffer 'Electran' | 2.5L |
| 12622 | Phosphate buffered saline (PBS) high phosphate | 10L |
| 12623 | Phosphate buffered saline (PBS) low phosphate | 10L |
| 12624 | Sodium dodecyl sulphate solution 'Electran' a 10% w/ | 100ML |
| 12625 | 3-[(3-Cholamidopropyl)dimethylammonio] -1-propane su | 1G |
| 12626 | 3-[(3-Cholamidopropyl)dimethylammonio] -1-propane su | 10G |
| 12627 | 3-[(3-Cholamidopropyl)dimethylammonio]- 2-hydroxy-1- | 1G |
| 12628 | 3-[(3-Cholamidopropyl)dimethylammonio]- 2-hydroxy-1- | 5G |
| 12629 | TAE Buffer 'Electran' | 1L |
| 12630 | TBE buffer 'Electran' | 5L |
| 12631 | TBE buffer 'Electran' | 2.5L |
| 12632 | Agarose low gelling temperature 'Electran' molecular | 25G |
| 12633 | Agarose low gelling temperature 'Electran' molecular | 100G |
| 12634 | Agarose high gel strength 'Electran' molecular biolo | 25G |
| 12635 | Agarose high gel strength 'Electran' molecular biolo | 100G |
| 12636 | Agarose high gel strength 'Electran' molecular biolo | 250G |
| 12637 | Deoxyribonucleic acid (from calf thymus) sonicated l | 50MG |
| 12638 | Diacrylyl-piperazine 'Electran' | 10G |
| 12639 | Sodium tetradecyl sulphate 'Electran' | 10G |
| 12640 | Instaview - SDS | EACH |
| 12641 | Instaview Native | 250ML |
| 12642 | 'Resolyte' 3.5-5 | 10ML |
| 12643 | 'Resolyte' 4-6 | 10ML |
| 12644 | 'Resolyte' 5-7 | 10ML |
| 12645 | 'Resolyte' 6-8 | 10ML |
| 12646 | 'Resolyte' 7-9 | 10ML |
| 12647 | di-Sodium hydrogen orthophosphate anhydrous molecula | 250G |
| 12648 | di-Sodium hydrogen orthophosphate anhydrous molecula | 1KG |
| 12649 | Sodium dihydrogen orthophosphate 1-hydrate molecular | 250G |
| 12650 | Sodium dihydrogen orthophosphate 1-hydrate molecular | 1KG |
| 12651 | Ammonium sulphate molecular biology grade | 100G |
| 12652 | Ammonium sulphate molecular biology grade | 1KG |
| 12653 | Citric acid molecular biology grade | 100G |
| 12654 | Citric acid molecular biology grade | 1KG |
| 12655 | Sodium dodecyl sulphate molecular biology grade | 50G |
| 12656 | Sodium dodecyl sulphate molecular biology grade | 500G |
| 12657 | Formamide molecular biology grade | 100ML |
| 12658 | Formamide molecular biology grade | 1L |
| 12659 | Glycerol molecular biology grade | 100ML |
| 12660 | Glycerol molecular biology grade | 1L |
| 12661 | Glycine molecular biology grade | 100G |
| 12662 | Glycine molecular biology grade | 1KG |
| 12663 | Acetic acid ("glacial") 'ARISTAR' 'Safe-Break' | 500ML |
| 12664 | Acetic acid ("glacial") 'ARISTAR' 'Safe-Break' | 2.5L |
| 12665 | Hydrochloric acid 'ARISTAR' sp. gr. 1.18 | 500ML |
| 12666 | Hydrochloric acid 'ARISTAR' sp. gr. 1.18 | 1L |
| 12667 | Nitric acid 'ARISTAR' 'Safe-Break' | 500ML |
| 12668 | Nitric acid 'ARISTAR' 'Safe-Break' | 1L |
| 12669 | Nitric acid 'ARISTAR' 'Safe-Break' | 2.5L |
| 12670 | Sulphuric acid 'ARISTAR' sp. gr. 1.84 'Safe-Break' | 500ML |
| 12671 | Sulphuric acid 'ARISTAR' sp. gr. 1.84 'Safe-Break' | 1L |
| 12672 | Sulphuric acid 'ARISTAR' sp. gr. 1.84 'Safe-Break' | 2.5L |
| 12673 | Hydrobromic acid 'ARISTAR' about 47% 'Safe-Break' | 500ML |
| 12674 | Orthophosphoric acid 'ARISTAR' 'Safe-Break' | 500ML |
| 12675 | Orthophosphoric acid 'ARISTAR' 'Safe-Break' | 2.5L |
| 12676 | Acetone 'ARISTAR' 'Safe-Break' | 1L |
| 12677 | Acetone 'ARISTAR' 'Safe-Break' | 2.5L |
| 12678 | Methanol 'ARISTAR' 'Safe-Break' | 1L |
| 12679 | Methanol 'ARISTAR' 'Safe-Break' | 2.5L |
| 12680 | Propan-2-ol (iso-propyl alcohol) 'ARISTAR' 'Safe-Bre | 1L |
| 12681 | Propan-2-ol (iso-propyl alcohol) 'ARISTAR' 'Safe-Bre | 2.5L |
| 12682 | Trichloroethylene 'ARISTAR' 'Safe-Break' | 1L |
| 12683 | Xylene 'ARISTAR' 'Safe-Break' | 2.5L |
| 12684 | Butan-1-ol 'ARISTAR' 'Safe-Break' | 1L |
| 12685 | Toluene 'ARISTAR' 'Safe-Break' | 2.5L |
| 12686 | Pyridine 'ARISTAR' 'Safe-Break' | 100ML |
| 12687 | Pyridine 'ARISTAR' 'Safe-Break' | 500ML |
| 12688 | Diethyl ether 'ARISTAR' 'Safe-Break' | 500ML |
| 12689 | Diethyl ether 'ARISTAR' 'Safe-Break' | 2.5L |
| 12690 | Chloroform 'ARISTAR' 'Safe-Break' | 500ML |
| 12691 | Chloroform 'ARISTAR' 'Safe-Break' | 2.5L |
| 12692 | 1,1,1-Trichloroethane 'ARISTAR' 'Safe-Break' | 500ML |
| 12693 | 1,1,1-Trichloroethane 'ARISTAR' 'Safe-Break' | 2.5L |
| 12694 | Dichloromethane 'ARISTAR' 'Safe-Break' | 500ML |
| 12695 | Dichloromethane 'ARISTAR' 'Safe-Break' | 2.5L |
| 12696 | Mercury 'ARISTAR' | 250G |
| 12697 | Sodium hydroxide pellets 'ARISTAR' | 500G |
| 12698 | D-Glucose 'ARISTAR' | 500G |
| 12699 | Ammonia solution 'ARISTAR' about 25% | 250ML |
| 12700 | Ammonia solution 'ARISTAR' about 25% | 1L |
| 12701 | Phosphorus 1,000 ppm single element standard for ICP | 100ML |
| 12702 | Sulphur 1,000 ppm single element standard for ICP 'A | 100ML |
| 12703 | 'Amberlite' IR-120(H) analytical grade particle size | 500G |
| 12704 | 'Amberlite' IR-120(Na) standard grade particle size | 500G |
| 12705 | 'Amberlite' LA-2 liquid ion exchange resin | 500ML |
| 12706 | 'Dowex' 50W-X8(H) standard grade | 500G |
| 12707 | 'Dowex' 1-X8(Cl) standard grade | 500G |
| 12708 | 'Duolite' MB6113 (Indicator) mixed resin | 500G |
| 12709 | 'Amberlite' IRC-50(H) standard grade particle size 0 | 500G |
| 12710 | 'Amberlyst' 15 macroreticular ion exchange resin | 500G |
| 12711 | 'Amberlite' IRA-93 standard grade particle size 0.30 | 500G |
| 12712 | 'Dowex' 1-X8(Cl) standard grade | 100G |
| 12713 | 'Dowex' 50W-X8(H) standard grade | 100G |
| 12714 | 'Dowex' 50W-X8(H) standard grade | 100G |
| 12715 | 'Dowex' 50W-X8(H) standard grade | 100G |
| 12716 | 'Amberlite' IRA-67 (free base) std grade particle si | 250G |
| 12717 | 'Amberlite' IRC-718 | 250G |
| 12718 | 'Amberlite' IRA-420(Cl) standard grade particle size | 500G |
| 12719 | 'Amberlite' IRA-416(Cl) standard grade particle size | 500G |
| 12720 | 'Amberlite' IRN-150L monobed mixed resin | 500G |
| 12721 | 'AMBERJET' 1200Na | 500G |
| 12722 | 'AMBERJET' 1200H | 500G |
| 12723 | 'AMBERJET' 4200Cl | 500G |
| 12724 | 'Brij 35' (polyoxyethylene lauryl ether) non-ionic s | 500G |
| 12725 | Nonidet P40 | 100ML |
| 12726 | *Hyamine 1622 | 250G |
| 12727 | Aerosol OT | 500G |
| 12728 | Dow Corning 200/0.65 cS silicone fluid | 250G |
| 12729 | Dow Corning 200/1 cS silicone fluid | 400G |
| 12730 | Dow Corning 200/5 cS silicone fluid | 400G |
| 12731 | Dow Corning 200/10 cS silicone fluid | 400G |
| 12732 | Dow Corning 200/20 cS silicone fluid | 500G |
| 12733 | Dow Corning 200/50 cS silicone fluid | 500G |
| 12734 | Dow Corning 200/100 cS silicone fluid | 500G |
| 12735 | Dow Corning 200/350 cS silicone fluid | 500G |
| 12736 | Dow Corning 200/500 cS silicone fluid | 500G |
| 12737 | Dow Corning 200/1000 cS silicone fluid | 500G |
| 12738 | Dow Corning 200/12,500 cS silicone fluid | 500G |
| 12739 | Dow Corning 200/30,000 cS silicone fluid | 500G |
| 12740 | Dow Corning 200/60,000 cS silicone fluid | 500G |
| 12741 | Dow Corning 210H/100 cS high temperature high shear | 500G |
| 12742 | Dow Corning 510/50 cS low temperature silicone fluid | 500G |
| 12743 | Dow Corning 550 high temperature low volatility sili | 500G |
| 12744 | Dow Corning 200/5,000 cS silicone fluid | 500G |
| 12745 | Dow Corning 200/10,000 cS silicone fluid | 500G |
| 12746 | Dow Corning 7 Compound long lasting heat stable rele | 100G |
| 12747 | Dow Corning Antifoam MSA Compound 100% active silico | 500G |
| 12748 | Dow Corning 1510 Antifoam for food processing indust | 500G |
| 12749 | Dow Corning Z-6020 amino-functional silane coupling | 500G |
| 12750 | RELEASIL B spray general purpose release agent with | 400ML |
| 12751 | Dow Corning DB-110A EU Antifoam Emulsion | 500G |
| 12752 | Repelcote VS water repellent | 500ML |
| 12753 | VolasilT 244 clear colourless volatile octamethylcyc | 100ML |
| 12754 | VolasilT 244 clear colourless volatile octamethylcyc | 2.5L |
| 12755 | VolasilT 245 clear colourless volatile decamethylcyc | 2.5L |
| 12756 | VolasilT 344 clear colourless volatile blend of cycl | 2.5L |
| 12757 | SILASTIC 3110 RTV low viscosity mould making and enc | 500G |
| 12758 | Dow Corning 3140 RTV pourable non-corrosive coating | 90ML |
| 12759 | Dow Corning 3145 Mil-A-46146 Adhesive Sealant Clear | 90ML |
| 12760 | Dow Corning 3145 Mil-A-46146 Adhesive Sealant Grey | 90ML |
| 12761 | MOLYKOTE 44M Grease general bearing lubricant | 100G |
| 12762 | MOLYKOTE FS 1292 Fluorosilicone Grease | 100G |
| 12763 | Dow Corning High Vacuum Grease low volatility lubric | 50G |
| 12764 | MOLYKOTE 1000 universal thread compound | 400ML |
| 12765 | MOLYKOTE Metal Protector plus corrosion preventative | 400ML |
| 12766 | MOLYKOTE 1102 Gas Cock Grease (25g Tube) | PK10 |
| 12767 | MOLYKOTE PTFE-N Spray | 300ML |
| 12768 | Polyvinyl alcohol 72000 | 1KG |
